Ampicillin

| width2 = 180 | alt2 =

| pronounce = | tradename = Principen, others | Drugs.com = | MedlinePlus = a685002 | licence_CA = | licence_EU = yes | DailyMedID = Ampicillin | licence_US = Ampicillin | pregnancy_AU = A | pregnancy_AU_comment = | pregnancy_US = B | pregnancy_US_comment = | pregnancy_category= | dependency_liability = | addiction_liability = | routes_of_administration = By mouth, intravenous, or intramuscular | class = Aminopenicillins | ATCvet = | ATC_prefix = J01 | ATC_suffix = CA01 | ATC_supplemental =

| legal_AU = S4 | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = | legal_CA_comment = | legal_DE = | legal_DE_comment = | legal_NZ = | legal_NZ_comment = | legal_UK = POM | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_UN = | legal_UN_comment = | legal_status =

| bioavailability = 62% ±17% (parenteral)
< 30–55% (oral) | protein_bound = 15 to 25% | metabolism = 12 to 50% | metabolites = Penicilloic acid | onset = | elimination_half-life = Approx. 1 hour | duration_of_action = | excretion = 75 to 85% renal

| CAS_number_Ref = | CAS_number = 69-53-4 | CAS_supplemental = | PubChem = 6249 | PubChemSubstance = | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = DB00415 | ChemSpiderID_Ref = | ChemSpiderID = 6013 | UNII_Ref = | UNII = 7C782967RD | KEGG_Ref = | KEGG = D00204 | KEGG2_Ref = | KEGG2 = C06574 | ChEBI_Ref = | ChEBI = 28971 | ChEMBL_Ref = | ChEMBL = 174 | NIAID_ChemDB = | PDB_ligand = AIC | synonyms = AM/AMP

| IUPAC_name = (2''S'',5''R'',6''R'')-6-([(2''R'')-2-Amino-2-phenylacetyl]amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | C=16 | H=19 | N=3 | O=4 | S=1 | SMILES = CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)C | Jmol = | StdInChI_Ref = | StdInChI = 1S/C16H19N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1 | StdInChI_comment = | StdInChIKey_Ref = | StdInChIKey = AVKUERGKIZMTKX-NJBDSQKTSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}

Ampicillin is an antibiotic belonging to the aminopenicillin class of the penicillin family. The drug is used to prevent and treat a number of bacterial infections, such as respiratory tract infections, urinary tract infections, meningitis, salmonellosis, and endocarditis. It may also be used to prevent group B streptococcal infection in newborns. It is used by mouth, by injection into a muscle, or intravenously.

Common side effects include rash, nausea, and diarrhea. It should not be used in people who are allergic to penicillin. Serious side effects may include ''Clostridium difficile'' colitis or anaphylaxis. While usable in those with kidney problems, the dose may need to be decreased. Its use during pregnancy and breastfeeding appears to be generally safe.

Ampicillin was discovered in 1958 and came into commercial use in 1961. It is on the World Health Organization's List of Essential Medicines. The World Health Organization classifies ampicillin as critically important for human medicine. It is available as a generic medication. Provided by Wikipedia